Created
August 25, 2024 07:41
-
-
Save kozo2/4352ccb5002c68a60275a3cfb9b50c8f to your computer and use it in GitHub Desktop.
try rdf-doctor for MassBank.json [MassBank.ttl is converted from MassBank.json]
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
(base) knishida@anna:~$ rdf-doctor -i MassBank.ttl | |
25/08/2024 07:21:13 -- turtle:(not compressed) | |
PREFIX dcterms: <http://purl.org/dc/terms/> | |
PREFIX ns1: <http://schema.org/> | |
PREFIX xsd: <http://www.w3.org/2001/XMLSchema#> | |
PREFIX : <http://weso.es/shapes/> | |
:ChemicalSubstance [<https://massbank.eu/MassBank/>~] AND # 117732 instances. Instance example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-HBM4EU-HB002846#ChemicalSubstance' | |
{ | |
<http://www.w3.org/1999/02/22-rdf-syntax-ns#type> [ns1:ChemicalSubstance] ; # 100.0 % (117732 instances). | |
ns1:url IRI ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-HBM4EU-HB002948' | |
ns1:chemicalComposition xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'C3H7NO3' | |
ns1:hasBioChemEntityPart @:MolecularEntity ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Eawag-EA005814#VHCNQEUWZYOAEV-UHFFFAOYSA-N' | |
dcterms:conformsTo @:CreativeWork ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://bioschemas.org/profiles/ChemicalSubstance/0.4-RELEASE' | |
ns1:identifier xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'MSBNK-NaToxAq-NA001603' | |
ns1:alternateName xsd:string +; # 100.0 % (117732 instances). | |
# Node constraint example: 'Ritonavir' | |
# 53.32534909795128 % (62781 instances). obj: xsd:string. Cardinality: {1} | |
# 29.37009479156049 % (34578 instances). obj: xsd:string. Cardinality: {2} | |
# 11.201712363673428 % (13188 instances). obj: xsd:string. Cardinality: {3} | |
ns1:name xsd:string # 100.0 % (117732 instances). | |
# Node constraint example: 'Malathion' | |
} | |
:MolecularEntity [<https://massbank.eu/MassBank/>~] AND # 117732 instances. Instance example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-AAFC-AC000004#KWILGNNWGSNMPA-UHFFFAOYSA-N' | |
{ | |
<http://www.w3.org/1999/02/22-rdf-syntax-ns#type> [ns1:MolecularEntity] ; # 100.0 % (117732 instances). | |
ns1:url IRI ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Chubu_Univ-UT000241' | |
dcterms:conformsTo @:CreativeWork ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://bioschemas.org/profiles/MolecularEntity/0.5-RELEASE' | |
ns1:molecularFormula xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'C11H11N' | |
ns1:monoisotopicMolecularWeight xsd:double ; # 100.0 % (117732 instances). | |
# Node constraint example: '578.526' | |
ns1:name xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: '3',5'-Cyclic CMP, cCMP, Cytidine-3',5'-cyclicmonophosphate' | |
ns1:identifier xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'MSBNK-HBM4EU-HB001343' | |
ns1:inChI xsd:string ?; | |
# Node constraint example: 'InChI=1S/C19H22N2O/c1-2-11-9-21-17-8-14-12-5-3-4-6-16(12)20-19(14)18(21)7-13(11)15(17)10-22/h2-6,13,15,17-18,20,22H,7-10H2,1H3/b11-2+/t13-,15+,17+,18+/m1/s1' | |
# 99.04613868786736 % (116609 instances). obj: xsd:string. Cardinality: {1} | |
ns1:inChIKey xsd:string ?; | |
# Node constraint example: 'RYYVLZVUVIJVGH-UHFFFAOYSA-N' | |
# 98.81595488057623 % (116338 instances). obj: xsd:string. Cardinality: {1} | |
ns1:smiles xsd:string ?; | |
# Node constraint example: 'CC(CCC(=O)NCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C' | |
# 81.89956851153467 % (96422 instances). obj: xsd:string. Cardinality: {1} | |
ns1:smiles <http://www.w3.org/1999/02/22-rdf-syntax-ns#langString> ? | |
# Node constraint example: 'CC(CCC(=O)NCC(=O)O)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C' | |
# 17.209424795297796 % (20261 instances). obj: <http://www.w3.org/1999/02/22-rdf-syntax-ns#langString>. Cardinality: {1} | |
} | |
:Dataset [<https://massbank.eu/MassBank/>~] AND # 117732 instances. Instance example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-BAFG-CSL2311091868#Dataset' | |
{ | |
<http://www.w3.org/1999/02/22-rdf-syntax-ns#type> [ns1:Dataset] ; # 100.0 % (117732 instances). | |
ns1:datePublished ns1:Date ; # 100.0 % (117732 instances). | |
# Node constraint example: '2023-11-09' | |
ns1:citation xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: '' | |
ns1:description xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'This MassBank record with Accession MSBNK-Waters-WA001361 contains the MS mass spectrum of Acamprosate with the InChIkey AFCGFAGUEYAMAO-UHFFFAOYSA-N.' | |
ns1:keywords @<BNode> ; # 100.0 % (117732 instances). | |
# Node constraint example: 'nc1a63166ee0e4a8ebce157cf8793c0bcb121397' | |
ns1:identifier xsd:string ; # 100.0 % (117732 instances). | |
# Node constraint example: 'MSBNK-Antwerp_Univ-AN116503' | |
ns1:measurementTechnique @<BNode> ; # 100.0 % (117732 instances). | |
# Node constraint example: 'nc1a63166ee0e4a8ebce157cf8793c0bcb233654' | |
ns1:includedinDataCatalog @<BNode> ; # 100.0 % (117732 instances). | |
# Node constraint example: 'nc1a63166ee0e4a8ebce157cf8793c0bcb559696' | |
dcterms:conformsTo @:CreativeWork ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://bioschemas.org/profiles/Dataset/1.0-RELEASE' | |
ns1:url IRI ; # 100.0 % (117732 instances). | |
# Node constraint example: 'https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-RIKEN_ReSpect-PS021102' | |
ns1:license IRI ?; | |
# Node constraint example: 'https://creativecommons.org/licenses/by/4.0/' | |
# 99.873441375327 % (117583 instances). obj: IRI. Cardinality: {1} | |
ns1:name xsd:string ? | |
# Node constraint example: 'L-Threonine; LC-ESI-QQ; MS2; CE:10 V; [M-H]-' | |
# 98.62059592973873 % (116108 instances). obj: xsd:string. Cardinality: {1} | |
} | |
:CreativeWork [<https://bioschemas.org/profiles/>~] AND # 3 instances. Instance example: 'https://bioschemas.org/profiles/MolecularEntity/0.5-RELEASE' | |
{ | |
<http://www.w3.org/1999/02/22-rdf-syntax-ns#type> [ns1:CreativeWork] # 100.0 % (3 instances). | |
} | |
(base) knishida@anna:~$ cd |
Sign up for free
to join this conversation on GitHub.
Already have an account?
Sign in to comment