This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| # Multi-stage build for a ROCm + MIGraphX + ONNX Runtime image on Ubuntu 24.04. | |
| # | |
| # This Dockerfile intentionally uses: | |
| # - A remote TheRock checkout as the ROCm source tree. | |
| # - A separate AMDMIGraphX build, because this TheRock checkout does not | |
| # currently build/install MIGraphX itself. | |
| # - ONNX Runtime's MIGraphX execution provider, not the deprecated ROCm EP. | |
| # | |
| # Build example: | |
| # docker build \ |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| { | |
| "version": "0.1.1", | |
| "notes": "", | |
| "platforms": { | |
| "windows-x86_64": { | |
| "signature": "", | |
| "url": "" | |
| }, | |
| "darwin-x86_64": { | |
| "signature": "", |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| from contextlib import asynccontextmanager | |
| import os | |
| from fastapi import FastAPI | |
| from langchain_openai import ChatOpenAI | |
| from sqlmodel import Field, Session, SQLModel, create_engine, select | |
| from pydantic.json_schema import SkipJsonSchema | |
| # class BaseJoke(SQLModel): | |
| # joke: str |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| ligand_id | smiles | |
|---|---|---|
| CHEMBL1087421 | COC1=C(C=C2C(=C1)CCN=C2C3=CC(=C(C=C3)Cl)Cl)Cl | |
| CHEMBL1088633 | COC1=C(C=C2C(=C1)CCN=C2C3=CC(=CC=C3)Cl)Cl | |
| CHEMBL1090360 | C1COCCN1C2=CC(=CC=C2)NC3=NC=CC(=N3)C4=C(N=C5N4C=CS5)C6=CC(=CC=C6)NC(=O)CC7=CC=CC=C7 | |
| CHEMBL1688215 | C1=CC2=C(C=C1C3=NC(=NC=C3)N)NN=C2N | |
| CHEMBL1765781 | CNC1=NC(=CN=C1)C2=CNC(=O)C(=C2)NC(=O)C3=CC=C(C=C3)N4CCCC4CN5CCCC5 | |
| CHEMBL1788116 | C1=CC=C2C(=C1)NC(=C(C#N)C3=NC(=NC=C3)NCCC4=CN=CC=C4)S2.C(=O)(C(F)(F)F)O.C(=O)(C(F)(F)F)O | |
| CHEMBL1929238 | CC(C)(C)C1=CC(=C(S1)NC(=O)NC2=C(C(=CC=C2)Cl)Cl)C(=O)N3CCC(=O)N(CC3)CCN(C)C | |
| CHEMBL1933552 | CC1CCC(CN1)N2CCC3(C2)CN(C4=CC=CC=C34)C(=O)C5=CC6=C(N5)C=C(C=C6)F | |
| CHEMBL202930 | COC1=C(C=CC(=C1)C2=CC3=C(C=C2)C(=CC4=CC=CN4)C(=O)N3)O |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import torch | |
| import nibabel as nib | |
| import numpy as np | |
| from tensordidct import TensorDict, MemmapTensor | |
| files_by_modality = { | |
| 'flair': [...] | |
| } | |
| num_files = ... |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import torch.nn as nn | |
| import torch.nn.functional as F | |
| class FlashAttentionTransformerEncoder(nn.Module): | |
| def __init__( | |
| self, | |
| dim_model, | |
| num_layers, | |
| num_heads=None, |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import time | |
| import torch | |
| import torch.nn as nn | |
| import torch.nn.functional as F | |
| bz = 128 | |
| seq_len = 512 | |
| d_model = 64 | |
| n_heads = 8 |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| """ | |
| Sample code for residue coloring in a dash-bio 3d molecule view | |
| Requirements: | |
| - dash | |
| - dash-bio | |
| - numpy | |
| - biopython | |
| pip install dash dash-bio numpy biopython |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| import torch | |
| import torch.distributed as dist | |
| import torch.multiprocessing as mp | |
| from torch.utils.data import IterableDataset, DataLoader | |
| class DistributedIterableDataset(IterableDataset): | |
| """ | |
| Example implementation of an IterableDataset that handles both multiprocessing (num_workers > 0) |
This file contains hidden or bidirectional Unicode text that may be interpreted or compiled differently than what appears below. To review, open the file in an editor that reveals hidden Unicode characters.
Learn more about bidirectional Unicode characters
| 1 n02119789 kit fox, Vulpes macrotis | |
| 2 n02100735 English setter | |
| 3 n02096294 Australian terrier | |
| 4 n02066245 grey whale, gray whale, devilfish, Eschrichtius gibbosus, Eschrichtius robustus | |
| 5 n02509815 lesser panda, red panda, panda, bear cat, cat bear, Ailurus fulgens | |
| 6 n02124075 Egyptian cat | |
| 7 n02417914 ibex, Capra ibex | |
| 8 n02123394 Persian cat | |
| 9 n02125311 cougar, puma, catamount, mountain lion, painter, panther, Felis concolor | |
| 10 n02423022 gazelle |
NewerOlder